C22H29F3N6O3S — CID 23070761
7-but-2-ynyl-2-cyclohexylsulfanyl-1-methyl-8-piperazin-1-ylpurin-6-one;2,2,2-trifluoroacetic acid (PubChem CID 23070761) has the molecular formula C22H29F3N6O3S and a molecular weight of 514.57 g/mol. Its IUPAC name is 7-but-2-ynyl-2-cyclohexylsulfanyl-1-methyl-8-piperazin-1-ylpurin-6-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-2-cyclohexylsulfanyl-1-methyl-8-piperazin-1-ylpurin-6-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23070761 |
| Molecular Formula | C22H29F3N6O3S |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 7-but-2-ynyl-2-cyclohexylsulfanyl-1-methyl-8-piperazin-1-ylpurin-6-one;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(SC3CCCCC3)n(C)c(=O)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28N6OS.C2HF3O2/c1-3-4-12-26-16-17(22-19(26)25-13-10-21-11-14-25)23-20(24(2)18(16)27)28-15-8-6-5-7-9-15;3-2(4,5)1(6)7/h15,21H,5-14H2,1-2H3;(H,6,7) |
| InChIKey | TVWXQSNUEPLOQA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|