C17H21N5O3S — CID 58638255
2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)sulfanylacetic acid (PubChem CID 58638255) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)sulfanylacetic acid.
| Compound Name | 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 58638255 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)sulfanylacetic acid |
| SMILES | CC#CCn1c(N2CCCCC2)nc2nc(SCC(=O)O)n(C)c(=O)c21 |
| InChI | InChI=1S/C17H21N5O3S/c1-3-4-10-22-13-14(18-16(22)21-8-6-5-7-9-21)19-17(20(2)15(13)25)26-11-12(23)24/h5-11H2,1-2H3,(H,23,24) |
| InChIKey | AJAQYEUJOBZMCJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|