C17H20N8OS2 — CID 23070752
7-but-2-ynyl-1-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-8-piperazin-1-ylpurin-6-one (PubChem CID 23070752) has the molecular formula C17H20N8OS2 and a molecular weight of 416.54 g/mol. Its IUPAC name is 7-but-2-ynyl-1-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-8-piperazin-1-ylpurin-6-one.
| Compound Name | 7-but-2-ynyl-1-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-8-piperazin-1-ylpurin-6-one |
|---|---|
| PubChem CID | 23070752 |
| Molecular Formula | C17H20N8OS2 |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 7-but-2-ynyl-1-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-8-piperazin-1-ylpurin-6-one |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(Sc3nnc(C)s3)n(C)c(=O)c21 |
| InChI | InChI=1S/C17H20N8OS2/c1-4-5-8-25-12-13(19-15(25)24-9-6-18-7-10-24)20-16(23(3)14(12)26)28-17-22-21-11(2)27-17/h18H,6-10H2,1-3H3 |
| InChIKey | ZAYGJBANRUAMDP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|