C16H19N7O2 — CID 22029556
2-(7-but-2-ynyl-1-methyl-2,6-dioxo-8-piperazin-1-ylpurin-3-yl)acetonitrile (PubChem CID 22029556) has the molecular formula C16H19N7O2 and a molecular weight of 341.38 g/mol. Its IUPAC name is 2-(7-but-2-ynyl-1-methyl-2,6-dioxo-8-piperazin-1-ylpurin-3-yl)acetonitrile.
| Compound Name | 2-(7-but-2-ynyl-1-methyl-2,6-dioxo-8-piperazin-1-ylpurin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 22029556 |
| Molecular Formula | C16H19N7O2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-(7-but-2-ynyl-1-methyl-2,6-dioxo-8-piperazin-1-ylpurin-3-yl)acetonitrile |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(C)c(=O)n2CC#N |
| InChI | InChI=1S/C16H19N7O2/c1-3-4-8-22-12-13(19-15(22)21-10-6-18-7-11-21)23(9-5-17)16(25)20(2)14(12)24/h18H,6-11H2,1-2H3 |
| InChIKey | CDZZADNBNWUKOY-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|