C26H25N7O2 — CID 68840515
4-[(7-but-2-ynyl-3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-1-yl)methyl]naphthalene-1-carbonitrile (PubChem CID 68840515) has the molecular formula C26H25N7O2 and a molecular weight of 467.53 g/mol. Its IUPAC name is 4-[(7-but-2-ynyl-3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-1-yl)methyl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(7-but-2-ynyl-3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-1-yl)methyl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 68840515 |
| Molecular Formula | C26H25N7O2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 4-[(7-but-2-ynyl-3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-1-yl)methyl]naphthalene-1-carbonitrile |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(Cc1ccc(C#N)c3ccccc13)c(=O)n2C |
| InChI | InChI=1S/C26H25N7O2/c1-3-4-13-32-22-23(29-25(32)31-14-11-28-12-15-31)30(2)26(35)33(24(22)34)17-19-10-9-18(16-27)20-7-5-6-8-21(19)20/h5-10,28H,11-15,17H2,1-2H3 |
| InChIKey | DNPIAYVRPHQWJK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|