C21H23ClN6O2 — CID 22029816
7-but-2-ynyl-1-[(3-chlorophenyl)methyl]-3-methyl-8-piperazin-1-ylpurine-2,6-dione (PubChem CID 22029816) has the molecular formula C21H23ClN6O2 and a molecular weight of 426.91 g/mol. Its IUPAC name is 7-but-2-ynyl-1-[(3-chlorophenyl)methyl]-3-methyl-8-piperazin-1-ylpurine-2,6-dione.
| Compound Name | 7-but-2-ynyl-1-[(3-chlorophenyl)methyl]-3-methyl-8-piperazin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 22029816 |
| Molecular Formula | C21H23ClN6O2 |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 7-but-2-ynyl-1-[(3-chlorophenyl)methyl]-3-methyl-8-piperazin-1-ylpurine-2,6-dione |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(Cc1cccc(Cl)c1)c(=O)n2C |
| InChI | InChI=1S/C21H23ClN6O2/c1-3-4-10-27-17-18(24-20(27)26-11-8-23-9-12-26)25(2)21(30)28(19(17)29)14-15-6-5-7-16(22)13-15/h5-7,13,23H,8-12,14H2,1-2H3 |
| InChIKey | LOEQXVJCJCDTRQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|