C24H27N9O2 — CID 122189870
7-but-2-ynyl-3-methyl-1-[(5-methyl-2-phenyltriazol-4-yl)methyl]-8-piperazin-1-ylpurine-2,6-dione (PubChem CID 122189870) has the molecular formula C24H27N9O2 and a molecular weight of 473.54 g/mol. Its IUPAC name is 7-but-2-ynyl-3-methyl-1-[(5-methyl-2-phenyltriazol-4-yl)methyl]-8-piperazin-1-ylpurine-2,6-dione.
| Compound Name | 7-but-2-ynyl-3-methyl-1-[(5-methyl-2-phenyltriazol-4-yl)methyl]-8-piperazin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 122189870 |
| Molecular Formula | C24H27N9O2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 7-but-2-ynyl-3-methyl-1-[(5-methyl-2-phenyltriazol-4-yl)methyl]-8-piperazin-1-ylpurine-2,6-dione |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(Cc1nn(-c3ccccc3)nc1C)c(=O)n2C |
| InChI | InChI=1S/C24H27N9O2/c1-4-5-13-31-20-21(26-23(31)30-14-11-25-12-15-30)29(3)24(35)32(22(20)34)16-19-17(2)27-33(28-19)18-9-7-6-8-10-18/h6-10,25H,11-16H2,1-3H3 |
| InChIKey | ZCFQBRPVMCXOFB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|