C24H26N8O2 — CID 68839957
7-but-2-ynyl-8-(1,4-diazepan-1-yl)-3-methyl-1-(1,5-naphthyridin-2-ylmethyl)purine-2,6-dione (PubChem CID 68839957) has the molecular formula C24H26N8O2 and a molecular weight of 458.53 g/mol. Its IUPAC name is 7-but-2-ynyl-8-(1,4-diazepan-1-yl)-3-methyl-1-(1,5-naphthyridin-2-ylmethyl)purine-2,6-dione.
| Compound Name | 7-but-2-ynyl-8-(1,4-diazepan-1-yl)-3-methyl-1-(1,5-naphthyridin-2-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 68839957 |
| Molecular Formula | C24H26N8O2 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 7-but-2-ynyl-8-(1,4-diazepan-1-yl)-3-methyl-1-(1,5-naphthyridin-2-ylmethyl)purine-2,6-dione |
| SMILES | CC#CCn1c(N2CCCNCC2)nc2c1c(=O)n(Cc1ccc3ncccc3n1)c(=O)n2C |
| InChI | InChI=1S/C24H26N8O2/c1-3-4-14-31-20-21(28-23(31)30-13-6-10-25-12-15-30)29(2)24(34)32(22(20)33)16-17-8-9-18-19(27-17)7-5-11-26-18/h5,7-9,11,25H,6,10,12-16H2,1-2H3 |
| InChIKey | XEBBTQUEFSHWCG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 102.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|