C26H28N8O2 — CID 68686814
8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-cyclopropyl-1-(1,5-naphthyridin-2-ylmethyl)purine-2,6-dione (PubChem CID 68686814) has the molecular formula C26H28N8O2 and a molecular weight of 484.56 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-cyclopropyl-1-(1,5-naphthyridin-2-ylmethyl)purine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-cyclopropyl-1-(1,5-naphthyridin-2-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 68686814 |
| Molecular Formula | C26H28N8O2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-cyclopropyl-1-(1,5-naphthyridin-2-ylmethyl)purine-2,6-dione |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1ccc3ncccc3n1)c(=O)n2C1CC1 |
| InChI | InChI=1S/C26H28N8O2/c1-2-3-14-32-22-23(30-25(32)31-13-5-6-17(27)15-31)34(19-9-10-19)26(36)33(24(22)35)16-18-8-11-20-21(29-18)7-4-12-28-20/h4,7-8,11-12,17,19H,5-6,9-10,13-16,27H2,1H3 |
| InChIKey | HYQJPFKJHVEWCT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 116.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|