C28H32N8O3 — CID 58022952
6-[(3R)-3-aminopiperidin-1-yl]-5-but-2-ynyl-N,N,1-trimethyl-3-(1,5-naphthyridin-2-ylmethyl)-2,4-dioxopyrrolo[3,2-d]pyrimidine-7-carboxamide (PubChem CID 58022952) has the molecular formula C28H32N8O3 and a molecular weight of 528.62 g/mol. Its IUPAC name is 6-[(3R)-3-aminopiperidin-1-yl]-5-but-2-ynyl-N,N,1-trimethyl-3-(1,5-naphthyridin-2-ylmethyl)-2,4-dioxopyrrolo[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | 6-[(3R)-3-aminopiperidin-1-yl]-5-but-2-ynyl-N,N,1-trimethyl-3-(1,5-naphthyridin-2-ylmethyl)-2,4-dioxopyrrolo[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 58022952 |
| Molecular Formula | C28H32N8O3 |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 6-[(3R)-3-aminopiperidin-1-yl]-5-but-2-ynyl-N,N,1-trimethyl-3-(1,5-naphthyridin-2-ylmethyl)-2,4-dioxopyrrolo[3,2-d]pyrimidine-7-carboxamide |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)c(C(=O)N(C)C)c2c1c(=O)n(Cc1ccc3ncccc3n1)c(=O)n2C |
| InChI | InChI=1S/C28H32N8O3/c1-5-6-15-35-24-23(22(26(37)32(2)3)25(35)34-14-8-9-18(29)16-34)33(4)28(39)36(27(24)38)17-19-11-12-20-21(31-19)10-7-13-30-20/h7,10-13,18H,8-9,14-17,29H2,1-4H3/t18-/m1/s1 |
| InChIKey | GRTXYTWWAVEKIG-GOSISDBHSA-N |
| XLogP | 1.15 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|