C23H24N8O2 — CID 68840359
7-but-2-ynyl-3-methyl-8-piperazin-1-yl-1-(quinazolin-6-ylmethyl)purine-2,6-dione (PubChem CID 68840359) has the molecular formula C23H24N8O2 and a molecular weight of 444.50 g/mol. Its IUPAC name is 7-but-2-ynyl-3-methyl-8-piperazin-1-yl-1-(quinazolin-6-ylmethyl)purine-2,6-dione.
| Compound Name | 7-but-2-ynyl-3-methyl-8-piperazin-1-yl-1-(quinazolin-6-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 68840359 |
| Molecular Formula | C23H24N8O2 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 7-but-2-ynyl-3-methyl-8-piperazin-1-yl-1-(quinazolin-6-ylmethyl)purine-2,6-dione |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(Cc1ccc3ncncc3c1)c(=O)n2C |
| InChI | InChI=1S/C23H24N8O2/c1-3-4-9-30-19-20(27-22(30)29-10-7-24-8-11-29)28(2)23(33)31(21(19)32)14-16-5-6-18-17(12-16)13-25-15-26-18/h5-6,12-13,15,24H,7-11,14H2,1-2H3 |
| InChIKey | FLHUSTWYXVFBHQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 102.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|