About 3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one
3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one (PubChem CID 23070898) has the molecular formula C15H19N5O
and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one.
Molecular Properties
| Compound Name | 3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one |
| PubChem CID | 23070898 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one |
| SMILES | CC#CCn1c(N2CCNCC2)nc2ccn(C)c(=O)c21 |
| InChI | InChI=1S/C15H19N5O/c1-3-4-8-20-13-12(5-9-18(2)14(13)21)17-15(20)19-10-6-16-7-11-19/h5,9,16H,6-8,10-11H2,1-2H3 |
| InChIKey | WYFONLBZXVYUTR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one?
The IUPAC name of 3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one (CID 23070898) is 3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one.
What is the SMILES notation for 3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one?
The canonical SMILES for 3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one is CC#CCn1c(N2CCNCC2)nc2ccn(C)c(=O)c21.
What is the InChIKey of 3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one?
The InChIKey is WYFONLBZXVYUTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O/c1-3-4-8-20-13-12(5-9-18(2)14(13)21)17-15(20)19-10-6-16-7-11-19/h5,9,16H,6-8,10-11H2,1-2H3.
What are the key properties of 3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one?
3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one has a molecular weight of 285.35 g/mol, XLogP of 0.17, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-2-ynyl-5-methyl-2-piperazin-1-ylimidazo[4,5-c]pyridin-4-one is sourced from PubChem (CID 23070898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).