C19H22N6O4 — CID 142105313
4-[(1,3-dimethyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)methyl]benzoic acid (PubChem CID 142105313) has the molecular formula C19H22N6O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 4-[(1,3-dimethyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)methyl]benzoic acid.
| Compound Name | 4-[(1,3-dimethyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 142105313 |
| Molecular Formula | C19H22N6O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 4-[(1,3-dimethyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)methyl]benzoic acid |
| SMILES | Cn1c(=O)c2c(nc(N3CCNCC3)n2Cc2ccc(C(=O)O)cc2)n(C)c1=O |
| InChI | InChI=1S/C19H22N6O4/c1-22-15-14(16(26)23(2)19(22)29)25(18(21-15)24-9-7-20-8-10-24)11-12-3-5-13(6-4-12)17(27)28/h3-6,20H,7-11H2,1-2H3,(H,27,28) |
| InChIKey | SJEBSCNJBBTQGO-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |