C15H21ClN6O2 — CID 1084935
7-(3-chlorobut-2-enyl)-1,3-dimethyl-8-piperazin-1-ylpurine-2,6-dione (PubChem CID 1084935) has the molecular formula C15H21ClN6O2 and a molecular weight of 352.83 g/mol. Its IUPAC name is 7-(3-chlorobut-2-enyl)-1,3-dimethyl-8-piperazin-1-ylpurine-2,6-dione.
| Compound Name | 7-(3-chlorobut-2-enyl)-1,3-dimethyl-8-piperazin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 1084935 |
| Molecular Formula | C15H21ClN6O2 |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 7-(3-chlorobut-2-enyl)-1,3-dimethyl-8-piperazin-1-ylpurine-2,6-dione |
| SMILES | CC(Cl)=CCn1c(N2CCNCC2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C15H21ClN6O2/c1-10(16)4-7-22-11-12(19(2)15(24)20(3)13(11)23)18-14(22)21-8-5-17-6-9-21/h4,17H,5-9H2,1-3H3 |
| InChIKey | GECCRDVRFNMRAJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |