C22H20N8O — CID 11441315
7-but-2-ynyl-1-[(2-cyanophenyl)methyl]-6-oxo-8-piperazin-1-ylpurine-2-carbonitrile (PubChem CID 11441315) has the molecular formula C22H20N8O and a molecular weight of 412.46 g/mol. Its IUPAC name is 7-but-2-ynyl-1-[(2-cyanophenyl)methyl]-6-oxo-8-piperazin-1-ylpurine-2-carbonitrile.
| Compound Name | 7-but-2-ynyl-1-[(2-cyanophenyl)methyl]-6-oxo-8-piperazin-1-ylpurine-2-carbonitrile |
|---|---|
| PubChem CID | 11441315 |
| Molecular Formula | C22H20N8O |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 7-but-2-ynyl-1-[(2-cyanophenyl)methyl]-6-oxo-8-piperazin-1-ylpurine-2-carbonitrile |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(C#N)n(Cc3ccccc3C#N)c(=O)c21 |
| InChI | InChI=1S/C22H20N8O/c1-2-3-10-29-19-20(27-22(29)28-11-8-25-9-12-28)26-18(14-24)30(21(19)31)15-17-7-5-4-6-16(17)13-23/h4-7,25H,8-12,15H2,1H3 |
| InChIKey | OPSYBASGLOSUDU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|