C28H26N6O — CID 58638478
2-[(3-but-2-ynyl-4-oxo-7-phenyl-2-piperidin-1-ylimidazo[4,5-d]pyridazin-5-yl)methyl]benzonitrile (PubChem CID 58638478) has the molecular formula C28H26N6O and a molecular weight of 462.56 g/mol. Its IUPAC name is 2-[(3-but-2-ynyl-4-oxo-7-phenyl-2-piperidin-1-ylimidazo[4,5-d]pyridazin-5-yl)methyl]benzonitrile.
| Compound Name | 2-[(3-but-2-ynyl-4-oxo-7-phenyl-2-piperidin-1-ylimidazo[4,5-d]pyridazin-5-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 58638478 |
| Molecular Formula | C28H26N6O |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 2-[(3-but-2-ynyl-4-oxo-7-phenyl-2-piperidin-1-ylimidazo[4,5-d]pyridazin-5-yl)methyl]benzonitrile |
| SMILES | CC#CCn1c(N2CCCCC2)nc2c(-c3ccccc3)nn(Cc3ccccc3C#N)c(=O)c21 |
| InChI | InChI=1S/C28H26N6O/c1-2-3-18-33-26-25(30-28(33)32-16-10-5-11-17-32)24(21-12-6-4-7-13-21)31-34(27(26)35)20-23-15-9-8-14-22(23)19-29/h4,6-9,12-15H,5,10-11,16-18,20H2,1H3 |
| InChIKey | MECMGRRTDIUDHD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 79.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|