C20H21N5O4 — CID 58638187
5-[(3-but-2-ynyl-4-oxo-2-piperidin-1-ylimidazo[4,5-d]pyridazin-5-yl)methyl]furan-2-carboxylic acid (PubChem CID 58638187) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is 5-[(3-but-2-ynyl-4-oxo-2-piperidin-1-ylimidazo[4,5-d]pyridazin-5-yl)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(3-but-2-ynyl-4-oxo-2-piperidin-1-ylimidazo[4,5-d]pyridazin-5-yl)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 58638187 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 5-[(3-but-2-ynyl-4-oxo-2-piperidin-1-ylimidazo[4,5-d]pyridazin-5-yl)methyl]furan-2-carboxylic acid |
| SMILES | CC#CCn1c(N2CCCCC2)nc2cnn(Cc3ccc(C(=O)O)o3)c(=O)c21 |
| InChI | InChI=1S/C20H21N5O4/c1-2-3-11-24-17-15(22-20(24)23-9-5-4-6-10-23)12-21-25(18(17)26)13-14-7-8-16(29-14)19(27)28/h7-8,12H,4-6,9-11,13H2,1H3,(H,27,28) |
| InChIKey | LDPJGEYLODNSDB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|