C22H25N9O — CID 21098090
3-but-2-ynyl-2-(1,4-diazepan-1-yl)-5-[(1-methylbenzotriazol-5-yl)methyl]imidazo[4,5-d]pyridazin-4-one (PubChem CID 21098090) has the molecular formula C22H25N9O and a molecular weight of 431.50 g/mol. Its IUPAC name is 3-but-2-ynyl-2-(1,4-diazepan-1-yl)-5-[(1-methylbenzotriazol-5-yl)methyl]imidazo[4,5-d]pyridazin-4-one.
| Compound Name | 3-but-2-ynyl-2-(1,4-diazepan-1-yl)-5-[(1-methylbenzotriazol-5-yl)methyl]imidazo[4,5-d]pyridazin-4-one |
|---|---|
| PubChem CID | 21098090 |
| Molecular Formula | C22H25N9O |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 3-but-2-ynyl-2-(1,4-diazepan-1-yl)-5-[(1-methylbenzotriazol-5-yl)methyl]imidazo[4,5-d]pyridazin-4-one |
| SMILES | CC#CCn1c(N2CCCNCC2)nc2cnn(Cc3ccc4c(c3)nnn4C)c(=O)c21 |
| InChI | InChI=1S/C22H25N9O/c1-3-4-11-30-20-18(25-22(30)29-10-5-8-23-9-12-29)14-24-31(21(20)32)15-16-6-7-19-17(13-16)26-27-28(19)2/h6-7,13-14,23H,5,8-12,15H2,1-2H3 |
| InChIKey | KPQCWGCVZQYCLX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|