About 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one
2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one (PubChem CID 21054526) has the molecular formula C22H26N6O
and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one.
Molecular Properties
| Compound Name | 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one |
| PubChem CID | 21054526 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2cnn(CCc3ccccc3)c(=O)c21 |
| InChI | InChI=1S/C22H26N6O/c1-2-3-13-27-20-19(25-22(27)26-12-7-10-18(23)16-26)15-24-28(21(20)29)14-11-17-8-5-4-6-9-17/h4-6,8-9,15,18H,7,10-14,16,23H2,1H3 |
| InChIKey | SOJBWLZVDFIUMM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one?
The IUPAC name of 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one (CID 21054526) is 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one.
What is the SMILES notation for 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one?
The canonical SMILES for 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one is CC#CCn1c(N2CCCC(N)C2)nc2cnn(CCc3ccccc3)c(=O)c21.
What is the InChIKey of 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one?
The InChIKey is SOJBWLZVDFIUMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N6O/c1-2-3-13-27-20-19(25-22(27)26-12-7-10-18(23)16-26)15-24-28(21(20)29)14-11-17-8-5-4-6-9-17/h4-6,8-9,15,18H,7,10-14,16,23H2,1H3.
What are the key properties of 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one?
2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one has a molecular weight of 390.49 g/mol, XLogP of 1.79, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-(2-phenylethyl)imidazo[4,5-d]pyridazin-4-one is sourced from PubChem (CID 21054526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).