C23H25N5O3 — CID 21054468
2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-[2-(2-hydroxyphenyl)-2-oxoethyl]imidazo[4,5-c]pyridin-4-one (PubChem CID 21054468) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-[2-(2-hydroxyphenyl)-2-oxoethyl]imidazo[4,5-c]pyridin-4-one.
| Compound Name | 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-[2-(2-hydroxyphenyl)-2-oxoethyl]imidazo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 21054468 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-5-[2-(2-hydroxyphenyl)-2-oxoethyl]imidazo[4,5-c]pyridin-4-one |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2ccn(CC(=O)c3ccccc3O)c(=O)c21 |
| InChI | InChI=1S/C23H25N5O3/c1-2-3-12-28-21-18(25-23(28)27-11-6-7-16(24)14-27)10-13-26(22(21)31)15-20(30)17-8-4-5-9-19(17)29/h4-5,8-10,13,16,29H,6-7,11-12,14-15,24H2,1H3 |
| InChIKey | SNZBBCIFWIWWFZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|