C27H29N7O4 — CID 68861428
2-[2-[2-[8-(3-aminopiperidin-1-yl)-7-benzyl-6-oxopurin-1-yl]acetyl]phenoxy]acetamide (PubChem CID 68861428) has the molecular formula C27H29N7O4 and a molecular weight of 515.57 g/mol. Its IUPAC name is 2-[2-[2-[8-(3-aminopiperidin-1-yl)-7-benzyl-6-oxopurin-1-yl]acetyl]phenoxy]acetamide.
| Compound Name | 2-[2-[2-[8-(3-aminopiperidin-1-yl)-7-benzyl-6-oxopurin-1-yl]acetyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 68861428 |
| Molecular Formula | C27H29N7O4 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 2-[2-[2-[8-(3-aminopiperidin-1-yl)-7-benzyl-6-oxopurin-1-yl]acetyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccccc1C(=O)Cn1cnc2nc(N3CCCC(N)C3)n(Cc3ccccc3)c2c1=O |
| InChI | InChI=1S/C27H29N7O4/c28-19-9-6-12-32(14-19)27-31-25-24(34(27)13-18-7-2-1-3-8-18)26(37)33(17-30-25)15-21(35)20-10-4-5-11-22(20)38-16-23(29)36/h1-5,7-8,10-11,17,19H,6,9,12-16,28H2,(H2,29,36) |
| InChIKey | GQJSLRBSMGEGHR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 151.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |