C19H25ClN6OS — CID 68858797
8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-2-methylsulfanylpurin-6-one;hydrochloride (PubChem CID 68858797) has the molecular formula C19H25ClN6OS and a molecular weight of 420.97 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-2-methylsulfanylpurin-6-one;hydrochloride.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-2-methylsulfanylpurin-6-one;hydrochloride |
|---|---|
| PubChem CID | 68858797 |
| Molecular Formula | C19H25ClN6OS |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-2-methylsulfanylpurin-6-one;hydrochloride |
| SMILES | CSc1nc2nc(N3CCCC(N)C3)n(Cc3ccccc3)c2c(=O)n1C.Cl |
| InChI | InChI=1S/C19H24N6OS.ClH/c1-23-17(26)15-16(22-19(23)27-2)21-18(24-10-6-9-14(20)12-24)25(15)11-13-7-4-3-5-8-13;/h3-5,7-8,14H,6,9-12,20H2,1-2H3;1H |
| InChIKey | SHTXEPKRVLXELJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |