C31H40N6O — CID 68860579
8-(3-aminopiperidin-1-yl)-7-benzyl-1-(4-methylpentyl)-2-(2-phenylethyl)purin-6-one (PubChem CID 68860579) has the molecular formula C31H40N6O and a molecular weight of 512.70 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-benzyl-1-(4-methylpentyl)-2-(2-phenylethyl)purin-6-one.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-1-(4-methylpentyl)-2-(2-phenylethyl)purin-6-one |
|---|---|
| PubChem CID | 68860579 |
| Molecular Formula | C31H40N6O |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-1-(4-methylpentyl)-2-(2-phenylethyl)purin-6-one |
| SMILES | CC(C)CCCn1c(CCc2ccccc2)nc2nc(N3CCCC(N)C3)n(Cc3ccccc3)c2c1=O |
| InChI | InChI=1S/C31H40N6O/c1-23(2)11-9-20-36-27(18-17-24-12-5-3-6-13-24)33-29-28(30(36)38)37(21-25-14-7-4-8-15-25)31(34-29)35-19-10-16-26(32)22-35/h3-8,12-15,23,26H,9-11,16-22,32H2,1-2H3 |
| InChIKey | SPEZDYJTUIHHLM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 81.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |