C21H26N8O — CID 68860855
3-[[8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-6-oxopurin-2-yl]amino]propanenitrile (PubChem CID 68860855) has the molecular formula C21H26N8O and a molecular weight of 406.49 g/mol. Its IUPAC name is 3-[[8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-6-oxopurin-2-yl]amino]propanenitrile.
| Compound Name | 3-[[8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-6-oxopurin-2-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 68860855 |
| Molecular Formula | C21H26N8O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 3-[[8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-6-oxopurin-2-yl]amino]propanenitrile |
| SMILES | Cn1c(NCCC#N)nc2nc(N3CCCC(N)C3)n(Cc3ccccc3)c2c1=O |
| InChI | InChI=1S/C21H26N8O/c1-27-19(30)17-18(25-20(27)24-11-6-10-22)26-21(28-12-5-9-16(23)14-28)29(17)13-15-7-3-2-4-8-15/h2-4,7-8,16H,5-6,9,11-14,23H2,1H3,(H,24,25) |
| InChIKey | IZYTVPWMGQQFJU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|