C26H31N7O2 — CID 68859347
8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-2-(2-phenoxyethylamino)purin-6-one (PubChem CID 68859347) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-2-(2-phenoxyethylamino)purin-6-one.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-2-(2-phenoxyethylamino)purin-6-one |
|---|---|
| PubChem CID | 68859347 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-2-(2-phenoxyethylamino)purin-6-one |
| SMILES | Cn1c(NCCOc2ccccc2)nc2nc(N3CCCC(N)C3)n(Cc3ccccc3)c2c1=O |
| InChI | InChI=1S/C26H31N7O2/c1-31-24(34)22-23(29-25(31)28-14-16-35-21-12-6-3-7-13-21)30-26(32-15-8-11-20(27)18-32)33(22)17-19-9-4-2-5-10-19/h2-7,9-10,12-13,20H,8,11,14-18,27H2,1H3,(H,28,29) |
| InChIKey | CNWUMMOGHJDFCZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|