C29H37N7O — CID 68861440
8-(3-aminopiperidin-1-yl)-7-benzyl-2-(benzylamino)-1-pentylpurin-6-one (PubChem CID 68861440) has the molecular formula C29H37N7O and a molecular weight of 499.66 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-benzyl-2-(benzylamino)-1-pentylpurin-6-one.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-2-(benzylamino)-1-pentylpurin-6-one |
|---|---|
| PubChem CID | 68861440 |
| Molecular Formula | C29H37N7O |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-2-(benzylamino)-1-pentylpurin-6-one |
| SMILES | CCCCCn1c(NCc2ccccc2)nc2nc(N3CCCC(N)C3)n(Cc3ccccc3)c2c1=O |
| InChI | InChI=1S/C29H37N7O/c1-2-3-10-18-35-27(37)25-26(32-28(35)31-19-22-12-6-4-7-13-22)33-29(34-17-11-16-24(30)21-34)36(25)20-23-14-8-5-9-15-23/h4-9,12-15,24H,2-3,10-11,16-21,30H2,1H3,(H,31,32) |
| InChIKey | LSEPJOQVNUUIFD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 94.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|