C24H32N6O — CID 68859461
8-(3-aminopiperidin-1-yl)-7-benzyl-2-hex-5-enyl-1-methylpurin-6-one (PubChem CID 68859461) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-benzyl-2-hex-5-enyl-1-methylpurin-6-one.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-2-hex-5-enyl-1-methylpurin-6-one |
|---|---|
| PubChem CID | 68859461 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-2-hex-5-enyl-1-methylpurin-6-one |
| SMILES | C=CCCCCc1nc2nc(N3CCCC(N)C3)n(Cc3ccccc3)c2c(=O)n1C |
| InChI | InChI=1S/C24H32N6O/c1-3-4-5-9-14-20-26-22-21(23(31)28(20)2)30(16-18-11-7-6-8-12-18)24(27-22)29-15-10-13-19(25)17-29/h3,6-8,11-12,19H,1,4-5,9-10,13-17,25H2,2H3 |
| InChIKey | DGAUHGLZDHQOAT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|