C31H33N7O — CID 68862132
8-(3-aminopiperidin-1-yl)-7-benzyl-2-(2-phenylethyl)-1-(pyridin-4-ylmethyl)purin-6-one (PubChem CID 68862132) has the molecular formula C31H33N7O and a molecular weight of 519.65 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-benzyl-2-(2-phenylethyl)-1-(pyridin-4-ylmethyl)purin-6-one.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-2-(2-phenylethyl)-1-(pyridin-4-ylmethyl)purin-6-one |
|---|---|
| PubChem CID | 68862132 |
| Molecular Formula | C31H33N7O |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-2-(2-phenylethyl)-1-(pyridin-4-ylmethyl)purin-6-one |
| SMILES | NC1CCCN(c2nc3nc(CCc4ccccc4)n(Cc4ccncc4)c(=O)c3n2Cc2ccccc2)C1 |
| InChI | InChI=1S/C31H33N7O/c32-26-12-7-19-36(22-26)31-35-29-28(38(31)21-24-10-5-2-6-11-24)30(39)37(20-25-15-17-33-18-16-25)27(34-29)14-13-23-8-3-1-4-9-23/h1-6,8-11,15-18,26H,7,12-14,19-22,32H2 |
| InChIKey | AGQBLUFXQUPLEF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |