C24H26N6OS — CID 135507265
8-(3-aminopiperidin-1-yl)-7-benzyl-2-benzylsulfanyl-1H-purin-6-one (PubChem CID 135507265) has the molecular formula C24H26N6OS and a molecular weight of 446.58 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-benzyl-2-benzylsulfanyl-1H-purin-6-one.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-2-benzylsulfanyl-1H-purin-6-one |
|---|---|
| PubChem CID | 135507265 |
| Molecular Formula | C24H26N6OS |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-2-benzylsulfanyl-1H-purin-6-one |
| SMILES | NC1CCCN(c2nc3nc(SCc4ccccc4)[nH]c(=O)c3n2Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H26N6OS/c25-19-12-7-13-29(15-19)24-27-21-20(30(24)14-17-8-3-1-4-9-17)22(31)28-23(26-21)32-16-18-10-5-2-6-11-18/h1-6,8-11,19H,7,12-16,25H2,(H,26,28,31) |
| InChIKey | VVQBWJDXSJIAQV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |