C24H24F2N6O2 — CID 22508635
8-(3-aminopiperidin-1-yl)-3-benzyl-7-[(2,5-difluorophenyl)methyl]purine-2,6-dione (PubChem CID 22508635) has the molecular formula C24H24F2N6O2 and a molecular weight of 466.49 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-3-benzyl-7-[(2,5-difluorophenyl)methyl]purine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-3-benzyl-7-[(2,5-difluorophenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 22508635 |
| Molecular Formula | C24H24F2N6O2 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-3-benzyl-7-[(2,5-difluorophenyl)methyl]purine-2,6-dione |
| SMILES | NC1CCCN(c2nc3c(c(=O)[nH]c(=O)n3Cc3ccccc3)n2Cc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C24H24F2N6O2/c25-17-8-9-19(26)16(11-17)13-31-20-21(28-23(31)30-10-4-7-18(27)14-30)32(24(34)29-22(20)33)12-15-5-2-1-3-6-15/h1-3,5-6,8-9,11,18H,4,7,10,12-14,27H2,(H,29,33,34) |
| InChIKey | RFGLYOZUHQMOPH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |