C26H31N7O — CID 68858843
8-(3-aminopiperidin-1-yl)-2-(benzylamino)-1-methyl-7-[(3-methylphenyl)methyl]purin-6-one (PubChem CID 68858843) has the molecular formula C26H31N7O and a molecular weight of 457.58 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-2-(benzylamino)-1-methyl-7-[(3-methylphenyl)methyl]purin-6-one.
| Compound Name | 8-(3-aminopiperidin-1-yl)-2-(benzylamino)-1-methyl-7-[(3-methylphenyl)methyl]purin-6-one |
|---|---|
| PubChem CID | 68858843 |
| Molecular Formula | C26H31N7O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-2-(benzylamino)-1-methyl-7-[(3-methylphenyl)methyl]purin-6-one |
| SMILES | Cc1cccc(Cn2c(N3CCCC(N)C3)nc3nc(NCc4ccccc4)n(C)c(=O)c32)c1 |
| InChI | InChI=1S/C26H31N7O/c1-18-8-6-11-20(14-18)16-33-22-23(30-26(33)32-13-7-12-21(27)17-32)29-25(31(2)24(22)34)28-15-19-9-4-3-5-10-19/h3-6,8-11,14,21H,7,12-13,15-17,27H2,1-2H3,(H,28,29) |
| InChIKey | HOKXUPLBAFQSAQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |