C24H36N6O3Si — CID 57498802
8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 57498802) has the molecular formula C24H36N6O3Si and a molecular weight of 484.68 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 57498802 |
| Molecular Formula | C24H36N6O3Si |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-benzyl-1-methyl-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCCC(N)C3)n2Cc2ccccc2)n(COCC[Si](C)(C)C)c1=O |
| InChI | InChI=1S/C24H36N6O3Si/c1-27-22(31)20-21(30(24(27)32)17-33-13-14-34(2,3)4)26-23(28-12-8-11-19(25)16-28)29(20)15-18-9-6-5-7-10-18/h5-7,9-10,19H,8,11-17,25H2,1-4H3 |
| InChIKey | LQQZGNLFRFAKHZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|