C26H38N4O3Si — CID 10528812
3-benzyl-8-cyclopentyl-1-propyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 10528812) has the molecular formula C26H38N4O3Si and a molecular weight of 482.70 g/mol. Its IUPAC name is 3-benzyl-8-cyclopentyl-1-propyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 3-benzyl-8-cyclopentyl-1-propyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 10528812 |
| Molecular Formula | C26H38N4O3Si |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 3-benzyl-8-cyclopentyl-1-propyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(C3CCCC3)n2COCC[Si](C)(C)C)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C26H38N4O3Si/c1-5-15-28-25(31)22-24(29(26(28)32)18-20-11-7-6-8-12-20)27-23(21-13-9-10-14-21)30(22)19-33-16-17-34(2,3)4/h6-8,11-12,21H,5,9-10,13-19H2,1-4H3 |
| InChIKey | UHYGJGBATOZDQL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|