C29H34N4O3 — CID 19699252
7-benzyl-8-cyclopentyl-3-[3-(4-hydroxyphenyl)propyl]-1-propylpurine-2,6-dione (PubChem CID 19699252) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 7-benzyl-8-cyclopentyl-3-[3-(4-hydroxyphenyl)propyl]-1-propylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-cyclopentyl-3-[3-(4-hydroxyphenyl)propyl]-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 19699252 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 7-benzyl-8-cyclopentyl-3-[3-(4-hydroxyphenyl)propyl]-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(C3CCCC3)n2Cc2ccccc2)n(CCCc2ccc(O)cc2)c1=O |
| InChI | InChI=1S/C29H34N4O3/c1-2-18-32-28(35)25-27(31(29(32)36)19-8-11-21-14-16-24(34)17-15-21)30-26(23-12-6-7-13-23)33(25)20-22-9-4-3-5-10-22/h3-5,9-10,14-17,23,34H,2,6-8,11-13,18-20H2,1H3 |
| InChIKey | WFVGKUIVCWPPEJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |