C19H21BrN4O3 — CID 11396361
3-benzyl-8-(bromomethyl)-7-(2-oxopropyl)-1-propylpurine-2,6-dione (PubChem CID 11396361) has the molecular formula C19H21BrN4O3 and a molecular weight of 433.31 g/mol. Its IUPAC name is 3-benzyl-8-(bromomethyl)-7-(2-oxopropyl)-1-propylpurine-2,6-dione.
| Compound Name | 3-benzyl-8-(bromomethyl)-7-(2-oxopropyl)-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 11396361 |
| Molecular Formula | C19H21BrN4O3 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 3-benzyl-8-(bromomethyl)-7-(2-oxopropyl)-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(CBr)n2CC(C)=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C19H21BrN4O3/c1-3-9-22-18(26)16-17(21-15(10-20)23(16)11-13(2)25)24(19(22)27)12-14-7-5-4-6-8-14/h4-8H,3,9-12H2,1-2H3 |
| InChIKey | ZIXUDSCHBROYIY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|