C30H28N4O3 — CID 23657006
1,3,7-tribenzyl-8-(1-ethoxyethenyl)purine-2,6-dione (PubChem CID 23657006) has the molecular formula C30H28N4O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is 1,3,7-tribenzyl-8-(1-ethoxyethenyl)purine-2,6-dione.
| Compound Name | 1,3,7-tribenzyl-8-(1-ethoxyethenyl)purine-2,6-dione |
|---|---|
| PubChem CID | 23657006 |
| Molecular Formula | C30H28N4O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 1,3,7-tribenzyl-8-(1-ethoxyethenyl)purine-2,6-dione |
| SMILES | C=C(OCC)c1nc2c(c(=O)n(Cc3ccccc3)c(=O)n2Cc2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C30H28N4O3/c1-3-37-22(2)27-31-28-26(32(27)19-23-13-7-4-8-14-23)29(35)34(21-25-17-11-6-12-18-25)30(36)33(28)20-24-15-9-5-10-16-24/h4-18H,2-3,19-21H2,1H3 |
| InChIKey | YXGYCKMGAYAQFD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|