C20H24N4O4 — CID 11485926
3-benzyl-8-(hydroxymethyl)-7-(3-oxobutan-2-yl)-1-propylpurine-2,6-dione (PubChem CID 11485926) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-benzyl-8-(hydroxymethyl)-7-(3-oxobutan-2-yl)-1-propylpurine-2,6-dione.
| Compound Name | 3-benzyl-8-(hydroxymethyl)-7-(3-oxobutan-2-yl)-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 11485926 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-benzyl-8-(hydroxymethyl)-7-(3-oxobutan-2-yl)-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(CO)n2C(C)C(C)=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C20H24N4O4/c1-4-10-22-19(27)17-18(21-16(12-25)24(17)13(2)14(3)26)23(20(22)28)11-15-8-6-5-7-9-15/h5-9,13,25H,4,10-12H2,1-3H3 |
| InChIKey | RPYPACIBJCYSNK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |