C23H22N4O4S — CID 82018291
2-(1,7-dibenzyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylpropanoic acid (PubChem CID 82018291) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is 2-(1,7-dibenzyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylpropanoic acid.
| Compound Name | 2-(1,7-dibenzyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 82018291 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-(1,7-dibenzyl-3-methyl-2,6-dioxopurin-8-yl)sulfanylpropanoic acid |
| SMILES | CC(Sc1nc2c(c(=O)n(Cc3ccccc3)c(=O)n2C)n1Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H22N4O4S/c1-15(21(29)30)32-22-24-19-18(26(22)13-16-9-5-3-6-10-16)20(28)27(23(31)25(19)2)14-17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3,(H,29,30) |
| InChIKey | GCKDTWBZJNDGOA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |