C21H28N4O3 — CID 21258190
7-benzyl-8-tert-butyl-3-(2-hydroxyethyl)-1-propylpurine-2,6-dione (PubChem CID 21258190) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 7-benzyl-8-tert-butyl-3-(2-hydroxyethyl)-1-propylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-tert-butyl-3-(2-hydroxyethyl)-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 21258190 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 7-benzyl-8-tert-butyl-3-(2-hydroxyethyl)-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(C(C)(C)C)n2Cc2ccccc2)n(CCO)c1=O |
| InChI | InChI=1S/C21H28N4O3/c1-5-11-24-18(27)16-17(23(12-13-26)20(24)28)22-19(21(2,3)4)25(16)14-15-9-7-6-8-10-15/h6-10,26H,5,11-14H2,1-4H3 |
| InChIKey | ZRWIDYWIGRQIKM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |