C23H24N4O3 — CID 135269355
7-benzyl-8-(4-methoxyphenyl)-3-methyl-1-propylpurine-2,6-dione (PubChem CID 135269355) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 7-benzyl-8-(4-methoxyphenyl)-3-methyl-1-propylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-(4-methoxyphenyl)-3-methyl-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 135269355 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 7-benzyl-8-(4-methoxyphenyl)-3-methyl-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(-c3ccc(OC)cc3)n2Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C23H24N4O3/c1-4-14-26-22(28)19-21(25(2)23(26)29)24-20(17-10-12-18(30-3)13-11-17)27(19)15-16-8-6-5-7-9-16/h5-13H,4,14-15H2,1-3H3 |
| InChIKey | XSTSZZTZSJVVRJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |