C24H27N5O2S — CID 144789104
7-benzyl-8-[4-(dimethylaminosulfanyl)phenyl]-3-methyl-1-propylpurine-2,6-dione (PubChem CID 144789104) has the molecular formula C24H27N5O2S and a molecular weight of 449.58 g/mol. Its IUPAC name is 7-benzyl-8-[4-(dimethylaminosulfanyl)phenyl]-3-methyl-1-propylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-[4-(dimethylaminosulfanyl)phenyl]-3-methyl-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 144789104 |
| Molecular Formula | C24H27N5O2S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 7-benzyl-8-[4-(dimethylaminosulfanyl)phenyl]-3-methyl-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(-c3ccc(SN(C)C)cc3)n2Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C24H27N5O2S/c1-5-15-28-23(30)20-22(27(4)24(28)31)25-21(29(20)16-17-9-7-6-8-10-17)18-11-13-19(14-12-18)32-26(2)3/h6-14H,5,15-16H2,1-4H3 |
| InChIKey | QGASIRVNARGNFJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|