C25H26N4O3 — CID 144762169
7-benzyl-1-(3-ethenoxypropyl)-3-methyl-8-(3-methylphenyl)purine-2,6-dione (PubChem CID 144762169) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 7-benzyl-1-(3-ethenoxypropyl)-3-methyl-8-(3-methylphenyl)purine-2,6-dione.
| Compound Name | 7-benzyl-1-(3-ethenoxypropyl)-3-methyl-8-(3-methylphenyl)purine-2,6-dione |
|---|---|
| PubChem CID | 144762169 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 7-benzyl-1-(3-ethenoxypropyl)-3-methyl-8-(3-methylphenyl)purine-2,6-dione |
| SMILES | C=COCCCn1c(=O)c2c(nc(-c3cccc(C)c3)n2Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C25H26N4O3/c1-4-32-15-9-14-28-24(30)21-23(27(3)25(28)31)26-22(20-13-8-10-18(2)16-20)29(21)17-19-11-6-5-7-12-19/h4-8,10-13,16H,1,9,14-15,17H2,2-3H3 |
| InChIKey | SRHXOJVFJIUJLI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|