C20H23N5O2 — CID 6492681
2-benzyl-4,7,8-trimethyl-6-propylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 6492681) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-benzyl-4,7,8-trimethyl-6-propylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 2-benzyl-4,7,8-trimethyl-6-propylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 6492681 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-benzyl-4,7,8-trimethyl-6-propylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCCn1c(C)c(C)n2c3c(=O)n(Cc4ccccc4)c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C20H23N5O2/c1-5-11-23-13(2)14(3)25-16-17(21-19(23)25)22(4)20(27)24(18(16)26)12-15-9-7-6-8-10-15/h6-10H,5,11-12H2,1-4H3 |
| InChIKey | QBSFZGDJOYJEEA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |