C22H26ClN5O3 — CID 6485031
2-[(3-chlorophenyl)methyl]-6-(3-ethoxypropyl)-4,7,8-trimethylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 6485031) has the molecular formula C22H26ClN5O3 and a molecular weight of 443.94 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-6-(3-ethoxypropyl)-4,7,8-trimethylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 2-[(3-chlorophenyl)methyl]-6-(3-ethoxypropyl)-4,7,8-trimethylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 6485031 |
| Molecular Formula | C22H26ClN5O3 |
| Molecular Weight | 443.94 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-6-(3-ethoxypropyl)-4,7,8-trimethylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCOCCCn1c(C)c(C)n2c3c(=O)n(Cc4cccc(Cl)c4)c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C22H26ClN5O3/c1-5-31-11-7-10-26-14(2)15(3)28-18-19(24-21(26)28)25(4)22(30)27(20(18)29)13-16-8-6-9-17(23)12-16/h6,8-9,12H,5,7,10-11,13H2,1-4H3 |
| InChIKey | PVWMUSRPBWEBSV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.94 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|