C19H19BrClN5O2 — CID 44903765
2-[(4-bromophenyl)methyl]-6-(2-chloroethyl)-4,7,8-trimethylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 44903765) has the molecular formula C19H19BrClN5O2 and a molecular weight of 464.75 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-6-(2-chloroethyl)-4,7,8-trimethylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 2-[(4-bromophenyl)methyl]-6-(2-chloroethyl)-4,7,8-trimethylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 44903765 |
| Molecular Formula | C19H19BrClN5O2 |
| Molecular Weight | 464.75 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-6-(2-chloroethyl)-4,7,8-trimethylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cc1c(C)n2c3c(=O)n(Cc4ccc(Br)cc4)c(=O)n(C)c3nc2n1CCCl |
| InChI | InChI=1S/C19H19BrClN5O2/c1-11-12(2)26-15-16(22-18(26)24(11)9-8-21)23(3)19(28)25(17(15)27)10-13-4-6-14(20)7-5-13/h4-7H,8-10H2,1-3H3 |
| InChIKey | YBYQOMYSIJYEKB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|