C19H22N8O2 — CID 17402993
3-benzyl-7-ethyl-1-[(1-propyltetrazol-5-yl)methyl]purine-2,6-dione (PubChem CID 17402993) has the molecular formula C19H22N8O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 3-benzyl-7-ethyl-1-[(1-propyltetrazol-5-yl)methyl]purine-2,6-dione.
| Compound Name | 3-benzyl-7-ethyl-1-[(1-propyltetrazol-5-yl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 17402993 |
| Molecular Formula | C19H22N8O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 3-benzyl-7-ethyl-1-[(1-propyltetrazol-5-yl)methyl]purine-2,6-dione |
| SMILES | CCCn1nnnc1Cn1c(=O)c2c(ncn2CC)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C19H22N8O2/c1-3-10-27-15(21-22-23-27)12-26-18(28)16-17(20-13-24(16)4-2)25(19(26)29)11-14-8-6-5-7-9-14/h5-9,13H,3-4,10-12H2,1-2H3 |
| InChIKey | HLCOMTVMNNIOLE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 105.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |