C22H23N5O4 — CID 41037792
2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]acetamide (PubChem CID 41037792) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 41037792 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-(3-benzyl-7-ethyl-2,6-dioxopurin-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]acetamide |
| SMILES | CCn1cnc2c1c(=O)n(CC(=O)N[C@@H](C)c1ccco1)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C22H23N5O4/c1-3-25-14-23-20-19(25)21(29)27(13-18(28)24-15(2)17-10-7-11-31-17)22(30)26(20)12-16-8-5-4-6-9-16/h4-11,14-15H,3,12-13H2,1-2H3,(H,24,28)/t15-/m0/s1 |
| InChIKey | NRQBWOWJUVGFCW-HNNXBMFYSA-N |
| XLogP | 1.90 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |