C24H25N5O3 — CID 112773960
2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)-N-propylacetamide (PubChem CID 112773960) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is 2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)-N-propylacetamide.
| Compound Name | 2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)-N-propylacetamide |
|---|---|
| PubChem CID | 112773960 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 2-(3,7-dibenzyl-2,6-dioxopurin-1-yl)-N-propylacetamide |
| SMILES | CCCNC(=O)Cn1c(=O)c2c(ncn2Cc2ccccc2)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C24H25N5O3/c1-2-13-25-20(30)16-29-23(31)21-22(26-17-27(21)14-18-9-5-3-6-10-18)28(24(29)32)15-19-11-7-4-8-12-19/h3-12,17H,2,13-16H2,1H3,(H,25,30) |
| InChIKey | ISEHHLJCGPELDB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |