C23H31N5O3 — CID 7420773
2-(3-benzyl-7-butyl-2,6-dioxopurin-1-yl)-N-[(2S)-pentan-2-yl]acetamide (PubChem CID 7420773) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-(3-benzyl-7-butyl-2,6-dioxopurin-1-yl)-N-[(2S)-pentan-2-yl]acetamide.
| Compound Name | 2-(3-benzyl-7-butyl-2,6-dioxopurin-1-yl)-N-[(2S)-pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 7420773 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 2-(3-benzyl-7-butyl-2,6-dioxopurin-1-yl)-N-[(2S)-pentan-2-yl]acetamide |
| SMILES | CCCCn1cnc2c1c(=O)n(CC(=O)N[C@@H](C)CCC)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C23H31N5O3/c1-4-6-13-26-16-24-21-20(26)22(30)28(15-19(29)25-17(3)10-5-2)23(31)27(21)14-18-11-8-7-9-12-18/h7-9,11-12,16-17H,4-6,10,13-15H2,1-3H3,(H,25,29)/t17-/m0/s1 |
| InChIKey | PIFODBQLLYMJMH-KRWDZBQOSA-N |
| XLogP | 2.51 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |