C25H35N5O3 — CID 42971291
2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-(4-phenylbutan-2-yl)acetamide (PubChem CID 42971291) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-(4-phenylbutan-2-yl)acetamide.
| Compound Name | 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-(4-phenylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 42971291 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-(4-phenylbutan-2-yl)acetamide |
| SMILES | CCCCn1cnc2c1c(=O)n(CC(=O)NC(C)CCc1ccccc1)c(=O)n2CCCC |
| InChI | InChI=1S/C25H35N5O3/c1-4-6-15-28-18-26-23-22(28)24(32)30(25(33)29(23)16-7-5-2)17-21(31)27-19(3)13-14-20-11-9-8-10-12-20/h8-12,18-19H,4-7,13-17H2,1-3H3,(H,27,31) |
| InChIKey | XBMXPKMYFQJPJT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |